C16H20ClNO — CID 105048494
1-(7-chloro-1-benzofuran-2-yl)-2-cyclopropyl-N-ethylpropan-1-amine (PubChem CID 105048494) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopropyl-N-ethylpropan-1-amine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopropyl-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 105048494 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-2-cyclopropyl-N-ethylpropan-1-amine |
| SMILES | CCNC(c1cc2cccc(Cl)c2o1)C(C)C1CC1 |
| InChI | InChI=1S/C16H20ClNO/c1-3-18-15(10(2)11-7-8-11)14-9-12-5-4-6-13(17)16(12)19-14/h4-6,9-11,15,18H,3,7-8H2,1-2H3 |
| InChIKey | HUOWDLMJCCHUMY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |