C16H22ClNOS — CID 114728971
1-(7-chloro-1-benzofuran-2-yl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine (PubChem CID 114728971) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 114728971 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
| SMILES | CCNC(CSCC(C)C)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C16H22ClNOS/c1-4-18-14(10-20-9-11(2)3)15-8-12-6-5-7-13(17)16(12)19-15/h5-8,11,14,18H,4,9-10H2,1-3H3 |
| InChIKey | CLNHASFGIUCDEE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |