C18H23ClO2 — CID 114726690
(7-chloro-1-benzofuran-2-yl)-(4-propan-2-ylcyclohexyl)methanol (PubChem CID 114726690) has the molecular formula C18H23ClO2 and a molecular weight of 306.83 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-(4-propan-2-ylcyclohexyl)methanol.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-(4-propan-2-ylcyclohexyl)methanol |
|---|---|
| PubChem CID | 114726690 |
| Molecular Formula | C18H23ClO2 |
| Molecular Weight | 306.83 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-(4-propan-2-ylcyclohexyl)methanol |
| SMILES | CC(C)C1CCC(C(O)c2cc3cccc(Cl)c3o2)CC1 |
| InChI | InChI=1S/C18H23ClO2/c1-11(2)12-6-8-13(9-7-12)17(20)16-10-14-4-3-5-15(19)18(14)21-16/h3-5,10-13,17,20H,6-9H2,1-2H3 |
| InChIKey | GZJAQNBAGPCITR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.83 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |