C14H16FNO3 — CID 114726911
(7-fluoro-1-benzofuran-2-yl)-(4-methylmorpholin-2-yl)methanol (PubChem CID 114726911) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-(4-methylmorpholin-2-yl)methanol.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-(4-methylmorpholin-2-yl)methanol |
|---|---|
| PubChem CID | 114726911 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-(4-methylmorpholin-2-yl)methanol |
| SMILES | CN1CCOC(C(O)c2cc3cccc(F)c3o2)C1 |
| InChI | InChI=1S/C14H16FNO3/c1-16-5-6-18-12(8-16)13(17)11-7-9-3-2-4-10(15)14(9)19-11/h2-4,7,12-13,17H,5-6,8H2,1H3 |
| InChIKey | SLYJBULONDEONM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |