C15H14F2N2OS — CID 106602173
[(3,4-difluorophenyl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine (PubChem CID 106602173) has the molecular formula C15H14F2N2OS and a molecular weight of 308.35 g/mol. Its IUPAC name is [(3,4-difluorophenyl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine.
| Compound Name | [(3,4-difluorophenyl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106602173 |
| Molecular Formula | C15H14F2N2OS |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [(3,4-difluorophenyl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(F)c(F)c1)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C15H14F2N2OS/c16-10-6-5-9(7-11(10)17)15(19-18)13-8-21-14-4-2-1-3-12(14)20-13/h1-7,13,15,19H,8,18H2 |
| InChIKey | XRZLTWKMIBJZQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|