C13H13BrN2O2S — CID 106602256
[(3-bromofuran-2-yl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine (PubChem CID 106602256) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is [(3-bromofuran-2-yl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromofuran-2-yl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106602256 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | [(3-bromofuran-2-yl)-(2,3-dihydro-1,4-benzoxathiin-2-yl)methyl]hydrazine |
| SMILES | NNC(c1occc1Br)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C13H13BrN2O2S/c14-8-5-6-17-13(8)12(16-15)10-7-19-11-4-2-1-3-9(11)18-10/h1-6,10,12,16H,7,15H2 |
| InChIKey | KDLQQGFQUAOOHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|