C14H15BrN2OS2 — CID 106602208
[2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzoxathiin-2-yl)ethyl]hydrazine (PubChem CID 106602208) has the molecular formula C14H15BrN2OS2 and a molecular weight of 371.33 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzoxathiin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzoxathiin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106602208 |
| Molecular Formula | C14H15BrN2OS2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzoxathiin-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1sccc1Br)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H15BrN2OS2/c15-9-5-6-19-14(9)7-10(17-16)12-8-20-13-4-2-1-3-11(13)18-12/h1-6,10,12,17H,7-8,16H2 |
| InChIKey | FGFLCGNIXHIMPK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|