C13H17N5OS — CID 106602195
[1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 106602195) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106602195 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | Cn1ncnc1CC(NN)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C13H17N5OS/c1-18-13(15-8-16-18)6-9(17-14)11-7-20-12-5-3-2-4-10(12)19-11/h2-5,8-9,11,17H,6-7,14H2,1H3 |
| InChIKey | JWXNIACEDHJBTN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|