C14H19N5S — CID 105318516
[1-(2,3-dihydro-1-benzothiophen-3-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105318516) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318516 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H19N5S/c1-2-19-14(16-9-17-19)7-12(18-15)11-8-20-13-6-4-3-5-10(11)13/h3-6,9,11-12,18H,2,7-8,15H2,1H3 |
| InChIKey | YNWZVVFDAUVFOD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|