C16H17ClN2S — CID 105286555
[2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethyl]hydrazine (PubChem CID 105286555) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105286555 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccccc1Cl)C1CSc2ccccc21 |
| InChI | InChI=1S/C16H17ClN2S/c17-14-7-3-1-5-11(14)9-15(19-18)13-10-20-16-8-4-2-6-12(13)16/h1-8,13,15,19H,9-10,18H2 |
| InChIKey | NZOFJYMICDAEAM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|