C15H16N4S2 — CID 105328740
[1-(2,3-dihydro-1-benzothiophen-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 105328740) has the molecular formula C15H16N4S2 and a molecular weight of 316.46 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105328740 |
| Molecular Formula | C15H16N4S2 |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [1-(2,3-dihydro-1-benzothiophen-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | NNC(Cc1cn2ccsc2n1)C1CSc2ccccc21 |
| InChI | InChI=1S/C15H16N4S2/c16-18-13(7-10-8-19-5-6-20-15(19)17-10)12-9-21-14-4-2-1-3-11(12)14/h1-6,8,12-13,18H,7,9,16H2 |
| InChIKey | CINUJHDOSGTBBY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|