C14H22N4S — CID 105233423
[1-(3-ethylcyclopentyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 105233423) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is [1-(3-ethylcyclopentyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(3-ethylcyclopentyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105233423 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [1-(3-ethylcyclopentyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | CCC1CCC(C(Cc2cn3ccsc3n2)NN)C1 |
| InChI | InChI=1S/C14H22N4S/c1-2-10-3-4-11(7-10)13(17-15)8-12-9-18-5-6-19-14(18)16-12/h5-6,9-11,13,17H,2-4,7-8,15H2,1H3 |
| InChIKey | NXKVUVNTJCNKFJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|