C17H26N2OS — CID 115828251
1-(4-butylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol (PubChem CID 115828251) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol.
| Compound Name | 1-(4-butylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
|---|---|
| PubChem CID | 115828251 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-(4-butylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
| SMILES | CCCCC1CCC(C(O)Cc2cn3ccsc3n2)CC1 |
| InChI | InChI=1S/C17H26N2OS/c1-2-3-4-13-5-7-14(8-6-13)16(20)11-15-12-19-9-10-21-17(19)18-15/h9-10,12-14,16,20H,2-8,11H2,1H3 |
| InChIKey | VTUGXXNGNOFZMG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |