C12H16N2OS — CID 115828299
3-cyclopropyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-ol (PubChem CID 115828299) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-cyclopropyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-ol.
| Compound Name | 3-cyclopropyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-ol |
|---|---|
| PubChem CID | 115828299 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-cyclopropyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-ol |
| SMILES | CC(C(O)Cc1cn2ccsc2n1)C1CC1 |
| InChI | InChI=1S/C12H16N2OS/c1-8(9-2-3-9)11(15)6-10-7-14-4-5-16-12(14)13-10/h4-5,7-9,11,15H,2-3,6H2,1H3 |
| InChIKey | HCXSFGOHONAMAP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |