C16H18N4S — CID 105234349
[1-(2,3-dihydro-1H-inden-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 105234349) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1H-inden-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105234349 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | NNC(Cc1cn2ccsc2n1)C1CCc2ccccc21 |
| InChI | InChI=1S/C16H18N4S/c17-19-15(9-12-10-20-7-8-21-16(20)18-12)14-6-5-11-3-1-2-4-13(11)14/h1-4,7-8,10,14-15,19H,5-6,9,17H2 |
| InChIKey | HUQVCLZNUNWVSD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|