C15H13ClN2S — CID 113289291
6-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 113289291) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 6-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 113289291 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | ClC1c2ccccc2CC1Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H13ClN2S/c16-14-11(7-10-3-1-2-4-13(10)14)8-12-9-18-5-6-19-15(18)17-12/h1-6,9,11,14H,7-8H2 |
| InChIKey | BFVWPOBXUHZUSL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|