C13H17ClN2S — CID 115334773
6-[(3-chlorocycloheptyl)methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 115334773) has the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 6-[(3-chlorocycloheptyl)methyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(3-chlorocycloheptyl)methyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 115334773 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-[(3-chlorocycloheptyl)methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | ClC1CCCCC(Cc2cn3ccsc3n2)C1 |
| InChI | InChI=1S/C13H17ClN2S/c14-11-4-2-1-3-10(7-11)8-12-9-16-5-6-17-13(16)15-12/h5-6,9-11H,1-4,7-8H2 |
| InChIKey | DZALOJLDFGHPHV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|