C15H24N4S — CID 105328743
(4-cyclohexyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-yl)hydrazine (PubChem CID 105328743) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is (4-cyclohexyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-yl)hydrazine.
| Compound Name | (4-cyclohexyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105328743 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (4-cyclohexyl-1-imidazo[2,1-b][1,3]thiazol-6-ylbutan-2-yl)hydrazine |
| SMILES | NNC(CCC1CCCCC1)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H24N4S/c16-18-13(7-6-12-4-2-1-3-5-12)10-14-11-19-8-9-20-15(19)17-14/h8-9,11-13,18H,1-7,10,16H2 |
| InChIKey | BVEULHKMQLYHSZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|