C14H22N4S2 — CID 105227723
(1-cyclohexylsulfanyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine (PubChem CID 105227723) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is (1-cyclohexylsulfanyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine.
| Compound Name | (1-cyclohexylsulfanyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105227723 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (1-cyclohexylsulfanyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-yl)hydrazine |
| SMILES | NNC(CSC1CCCCC1)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C14H22N4S2/c15-17-12(10-20-13-4-2-1-3-5-13)8-11-9-18-6-7-19-14(18)16-11/h6-7,9,12-13,17H,1-5,8,10,15H2 |
| InChIKey | VVVFPYSCPXBXHC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|