C11H18N4OS — CID 105209912
(1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propoxypropan-2-yl)hydrazine (PubChem CID 105209912) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propoxypropan-2-yl)hydrazine.
| Compound Name | (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propoxypropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105209912 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propoxypropan-2-yl)hydrazine |
| SMILES | CCCOCC(Cc1cn2ccsc2n1)NN |
| InChI | InChI=1S/C11H18N4OS/c1-2-4-16-8-10(14-12)6-9-7-15-3-5-17-11(15)13-9/h3,5,7,10,14H,2,4,6,8,12H2,1H3 |
| InChIKey | KDPRAFFRXIOHRJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|