C15H24N4S — CID 107194550
[1-(2,2-dimethylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine (PubChem CID 107194550) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is [1-(2,2-dimethylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine.
| Compound Name | [1-(2,2-dimethylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107194550 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [1-(2,2-dimethylcyclohexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethyl]hydrazine |
| SMILES | CC1(C)CCCCC1C(Cc1cn2ccsc2n1)NN |
| InChI | InChI=1S/C15H24N4S/c1-15(2)6-4-3-5-12(15)13(18-16)9-11-10-19-7-8-20-14(19)17-11/h7-8,10,12-13,18H,3-6,9,16H2,1-2H3 |
| InChIKey | BVDJZOHMTLTMBF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|