C11H14ClN3S — CID 115334519
1-(3-chlorocyclobutyl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)methanamine (PubChem CID 115334519) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 1-(3-chlorocyclobutyl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)methanamine.
| Compound Name | 1-(3-chlorocyclobutyl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)methanamine |
|---|---|
| PubChem CID | 115334519 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(3-chlorocyclobutyl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)methanamine |
| SMILES | ClC1CC(CNCc2cn3ccsc3n2)C1 |
| InChI | InChI=1S/C11H14ClN3S/c12-9-3-8(4-9)5-13-6-10-7-15-1-2-16-11(15)14-10/h1-2,7-9,13H,3-6H2 |
| InChIKey | JLQCCOHSLZGSQJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|