C9H12BrN3S — CID 115334551
3-bromo-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propan-1-amine (PubChem CID 115334551) has the molecular formula C9H12BrN3S and a molecular weight of 274.19 g/mol. Its IUPAC name is 3-bromo-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propan-1-amine.
| Compound Name | 3-bromo-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115334551 |
| Molecular Formula | C9H12BrN3S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 3-bromo-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propan-1-amine |
| SMILES | BrCCCNCc1cn2ccsc2n1 |
| InChI | InChI=1S/C9H12BrN3S/c10-2-1-3-11-6-8-7-13-4-5-14-9(13)12-8/h4-5,7,11H,1-3,6H2 |
| InChIKey | XFOGHQUGVVVQOX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|