About methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate
methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate (PubChem CID 115331415) has the molecular formula C9H11N3O2S
and a molecular weight of 225.27 g/mol. Its IUPAC name is methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate.
Analyze methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The IUPAC name of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate (CID 115331415) is methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate.
What is the SMILES notation for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The canonical SMILES for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate is COC(=O)CNCc1cn2ccsc2n1.
What is the InChIKey of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The InChIKey is KNERUKAYGMEDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2S/c1-14-8(13)5-10-4-7-6-12-2-3-15-9(12)11-7/h2-3,6,10H,4-5H2,1H3.
What are the key properties of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate has a molecular weight of 225.27 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate is sourced from PubChem (CID 115331415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).