methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate

C9H11N3O2S — CID 115331415

IUPACmethyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate
SMILESCOC(=O)CNCc1cn2ccsc2n1
InChIInChI=1S/C9H11N3O2S/c1-14-8(13)5-10-4-7-6-12-2-3-15-9(12)11-7/h2-3,6,10H,4-5H2,1H3
InChIKeyKNERUKAYGMEDFL-UHFFFAOYSA-N
MW225.27 g/mol
LogP0.66
Rot. Bonds4

About methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate

methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate (PubChem CID 115331415) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate.

Molecular Properties

Compound Namemethyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate
PubChem CID115331415
Molecular FormulaC9H11N3O2S
Molecular Weight225.27 g/mol
Exact Mass225.06
IUPAC Namemethyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate
SMILESCOC(=O)CNCc1cn2ccsc2n1
InChIInChI=1S/C9H11N3O2S/c1-14-8(13)5-10-4-7-6-12-2-3-15-9(12)11-7/h2-3,6,10H,4-5H2,1H3
InChIKeyKNERUKAYGMEDFL-UHFFFAOYSA-N
XLogP0.66
TPSA55.63 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.27
LogP ≤ 50.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The IUPAC name of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate (CID 115331415) is methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate.
What is the SMILES notation for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The canonical SMILES for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate is COC(=O)CNCc1cn2ccsc2n1.
What is the InChIKey of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
The InChIKey is KNERUKAYGMEDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2S/c1-14-8(13)5-10-4-7-6-12-2-3-15-9(12)11-7/h2-3,6,10H,4-5H2,1H3.
What are the key properties of methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate?
methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate has a molecular weight of 225.27 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)acetate is sourced from PubChem (CID 115331415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).