C10H12ClN3O2S — CID 103491939
methyl 2-chloro-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)propanoate (PubChem CID 103491939) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is methyl 2-chloro-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)propanoate.
| Compound Name | methyl 2-chloro-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 103491939 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl 2-chloro-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)propanoate |
| SMILES | COC(=O)C(Cl)CNCc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H12ClN3O2S/c1-16-9(15)8(11)5-12-4-7-6-14-2-3-17-10(14)13-7/h2-3,6,8,12H,4-5H2,1H3 |
| InChIKey | DFIPNHTZHYIQHS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|