C14H23N5S — CID 105239505
(1-imidazo[2,1-b][1,3]thiazol-6-yl-3-methyl-3-pyrrolidin-1-ylbutan-2-yl)hydrazine (PubChem CID 105239505) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-methyl-3-pyrrolidin-1-ylbutan-2-yl)hydrazine.
| Compound Name | (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-methyl-3-pyrrolidin-1-ylbutan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105239505 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (1-imidazo[2,1-b][1,3]thiazol-6-yl-3-methyl-3-pyrrolidin-1-ylbutan-2-yl)hydrazine |
| SMILES | CC(C)(C(Cc1cn2ccsc2n1)NN)N1CCCC1 |
| InChI | InChI=1S/C14H23N5S/c1-14(2,19-5-3-4-6-19)12(17-15)9-11-10-18-7-8-20-13(18)16-11/h7-8,10,12,17H,3-6,9,15H2,1-2H3 |
| InChIKey | VEIGITBPTQEDRS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|