C16H23N5 — CID 105218898
[2-(2-ethyl-1,2,4-triazol-3-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine (PubChem CID 105218898) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105218898 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)C1CCCc2ccccc21 |
| InChI | InChI=1S/C16H23N5/c1-2-21-16(18-11-19-21)10-15(20-17)14-9-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,11,14-15,20H,2,5,7,9-10,17H2,1H3 |
| InChIKey | ZCWLZLIATZVHCG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|