C17H23N3S — CID 105218793
[2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine (PubChem CID 105218793) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine.
| Compound Name | [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105218793 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)C2CCCc3ccccc32)sc1C |
| InChI | InChI=1S/C17H23N3S/c1-11-12(2)21-17(19-11)10-16(20-18)15-9-5-7-13-6-3-4-8-14(13)15/h3-4,6,8,15-16,20H,5,7,9-10,18H2,1-2H3 |
| InChIKey | KBGAHBGNRFCJSW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|