C17H17N3S — CID 105224743
[2-(1,3-benzothiazol-2-yl)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]hydrazine (PubChem CID 105224743) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105224743 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]hydrazine |
| SMILES | NNC(Cc1nc2ccccc2s1)C1Cc2ccccc21 |
| InChI | InChI=1S/C17H17N3S/c18-20-15(13-9-11-5-1-2-6-12(11)13)10-17-19-14-7-3-4-8-16(14)21-17/h1-8,13,15,20H,9-10,18H2 |
| InChIKey | HZMFCOMAJJSWRE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|