C13H16N2S — CID 43118643
2-(1,3-benzothiazol-2-yl)-1-cyclobutylethanamine (PubChem CID 43118643) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-cyclobutylethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-cyclobutylethanamine |
|---|---|
| PubChem CID | 43118643 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-cyclobutylethanamine |
| SMILES | NC(Cc1nc2ccccc2s1)C1CCC1 |
| InChI | InChI=1S/C13H16N2S/c14-10(9-4-3-5-9)8-13-15-11-6-1-2-7-12(11)16-13/h1-2,6-7,9-10H,3-5,8,14H2 |
| InChIKey | OFQWGTFMONRGSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |