C13H19N5S — CID 105316509
[2-(2-methyl-1,2,4-triazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine (PubChem CID 105316509) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is [2-(2-methyl-1,2,4-triazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,2,4-triazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316509 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [2-(2-methyl-1,2,4-triazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine |
| SMILES | Cn1ncnc1CC(NN)C1CCCc2sccc21 |
| InChI | InChI=1S/C13H19N5S/c1-18-13(15-8-16-18)7-11(17-14)9-3-2-4-12-10(9)5-6-19-12/h5-6,8-9,11,17H,2-4,7,14H2,1H3 |
| InChIKey | MCANFYBISPOMTE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|