C15H22N4S — CID 105315787
[2-(2,5-dimethylpyrazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine (PubChem CID 105315787) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is [2-(2,5-dimethylpyrazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2,5-dimethylpyrazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105315787 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [2-(2,5-dimethylpyrazol-3-yl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]hydrazine |
| SMILES | Cc1cc(CC(NN)C2CCCc3sccc32)n(C)n1 |
| InChI | InChI=1S/C15H22N4S/c1-10-8-11(19(2)18-10)9-14(17-16)12-4-3-5-15-13(12)6-7-20-15/h6-8,12,14,17H,3-5,9,16H2,1-2H3 |
| InChIKey | VTESVYYVIUFBSC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|