C13H17N5S — CID 114213664
[2,3-dihydro-1-benzothiophen-3-yl-(3-ethyltriazol-4-yl)methyl]hydrazine (PubChem CID 114213664) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is [2,3-dihydro-1-benzothiophen-3-yl-(3-ethyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1-benzothiophen-3-yl-(3-ethyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114213664 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [2,3-dihydro-1-benzothiophen-3-yl-(3-ethyltriazol-4-yl)methyl]hydrazine |
| SMILES | CCn1nncc1C(NN)C1CSc2ccccc21 |
| InChI | InChI=1S/C13H17N5S/c1-2-18-11(7-15-17-18)13(16-14)10-8-19-12-6-4-3-5-9(10)12/h3-7,10,13,16H,2,8,14H2,1H3 |
| InChIKey | QBLITHNZJIREOF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|