C14H20N2OS — CID 106602324
[1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-methylidenepentyl]hydrazine (PubChem CID 106602324) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-methylidenepentyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-methylidenepentyl]hydrazine |
|---|---|
| PubChem CID | 106602324 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-methylidenepentyl]hydrazine |
| SMILES | C=C(CC)CC(NN)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H20N2OS/c1-3-10(2)8-11(16-15)13-9-18-14-7-5-4-6-12(14)17-13/h4-7,11,13,16H,2-3,8-9,15H2,1H3 |
| InChIKey | DKIQPUSKCFILSC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|