C14H15BrN2O2S — CID 105230271
[2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]hydrazine (PubChem CID 105230271) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105230271 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1sccc1Br)C1COc2ccccc2O1 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-9-5-6-20-14(9)7-10(17-16)13-8-18-11-3-1-2-4-12(11)19-13/h1-6,10,13,17H,7-8,16H2 |
| InChIKey | RDYKXNJJRPQXLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|