C13H18N2O2 — CID 105230212
1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-enylhydrazine (PubChem CID 105230212) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-enylhydrazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105230212 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-3-6-10(15-14)13-9-16-11-7-4-5-8-12(11)17-13/h2,4-5,7-8,10,13,15H,1,3,6,9,14H2 |
| InChIKey | IMNNRQSLUNAKJA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|