C10H14O — CID 143361819
(3S)-3-cyclohexa-2,4-dien-1-ylbutan-2-one (PubChem CID 143361819) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (3S)-3-cyclohexa-2,4-dien-1-ylbutan-2-one.
| Compound Name | (3S)-3-cyclohexa-2,4-dien-1-ylbutan-2-one |
|---|---|
| PubChem CID | 143361819 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (3S)-3-cyclohexa-2,4-dien-1-ylbutan-2-one |
| SMILES | CC(=O)[C@@H](C)C1C=CC=CC1 |
| InChI | InChI=1S/C10H14O/c1-8(9(2)11)10-6-4-3-5-7-10/h3-6,8,10H,7H2,1-2H3/t8-,10?/m1/s1 |
| InChIKey | YWRQOIOGSGDBMA-HNHGDDPOSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |