C9H14 — CID 134896176
(5R)-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 134896176) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is (5R)-5-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | (5R)-5-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134896176 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (5R)-5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC(C)[C@@H]1C=CC=CC1 |
| InChI | InChI=1S/C9H14/c1-8(2)9-6-4-3-5-7-9/h3-6,8-9H,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | VXIBOZDOTNVUEQ-SECBINFHSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |