3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid

C10H15NO2 — CID 145086383

IUPAC3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid
SMILESCNC(CC(=O)O)C1C=CC=CC1
InChIInChI=1S/C10H15NO2/c1-11-9(7-10(12)13)8-5-3-2-4-6-8/h2-5,8-9,11H,6-7H2,1H3,(H,12,13)
InChIKeyWYVSAVCWVBLUOB-UHFFFAOYSA-N
MW181.23 g/mol
LogP1.18
Rot. Bonds4

About 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid

3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid (PubChem CID 145086383) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid.

Molecular Properties

Compound Name3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid
PubChem CID145086383
Molecular FormulaC10H15NO2
Molecular Weight181.23 g/mol
Exact Mass181.11
IUPAC Name3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid
SMILESCNC(CC(=O)O)C1C=CC=CC1
InChIInChI=1S/C10H15NO2/c1-11-9(7-10(12)13)8-5-3-2-4-6-8/h2-5,8-9,11H,6-7H2,1H3,(H,12,13)
InChIKeyWYVSAVCWVBLUOB-UHFFFAOYSA-N
XLogP1.18
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.23
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid?
The IUPAC name of 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid (CID 145086383) is 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid.
What is the SMILES notation for 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid?
The canonical SMILES for 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid is CNC(CC(=O)O)C1C=CC=CC1.
What is the InChIKey of 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid?
The InChIKey is WYVSAVCWVBLUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11-9(7-10(12)13)8-5-3-2-4-6-8/h2-5,8-9,11H,6-7H2,1H3,(H,12,13).
What are the key properties of 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid?
3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid has a molecular weight of 181.23 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid is sourced from PubChem (CID 145086383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).