C10H15NO2 — CID 145086383
3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid (PubChem CID 145086383) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 145086383 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-3-(methylamino)propanoic acid |
| SMILES | CNC(CC(=O)O)C1C=CC=CC1 |
| InChI | InChI=1S/C10H15NO2/c1-11-9(7-10(12)13)8-5-3-2-4-6-8/h2-5,8-9,11H,6-7H2,1H3,(H,12,13) |
| InChIKey | WYVSAVCWVBLUOB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |