C9H14NNaO2 — CID 174620375
sodium;carbanide;2-(cyclohexa-2,4-dien-1-ylamino)acetic acid (PubChem CID 174620375) has the molecular formula C9H14NNaO2 and a molecular weight of 191.21 g/mol. Its IUPAC name is sodium;carbanide;2-(cyclohexa-2,4-dien-1-ylamino)acetic acid.
| Compound Name | sodium;carbanide;2-(cyclohexa-2,4-dien-1-ylamino)acetic acid |
|---|---|
| PubChem CID | 174620375 |
| Molecular Formula | C9H14NNaO2 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | sodium;carbanide;2-(cyclohexa-2,4-dien-1-ylamino)acetic acid |
| SMILES | O=C(O)CNC1C=CC=CC1.[CH3-].[Na+] |
| InChI | InChI=1S/C8H11NO2.CH3.Na/c10-8(11)6-9-7-4-2-1-3-5-7;;/h1-4,7,9H,5-6H2,(H,10,11);1H3;/q;-1;+1 |
| InChIKey | GGNCRMUCCHYPNC-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|