C15H21N3O2 — CID 123380917
2-amino-N-cyclohexa-2,4-dien-1-yl-N'-cyclohex-3-en-1-ylpropanediamide (PubChem CID 123380917) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-amino-N-cyclohexa-2,4-dien-1-yl-N'-cyclohex-3-en-1-ylpropanediamide.
| Compound Name | 2-amino-N-cyclohexa-2,4-dien-1-yl-N'-cyclohex-3-en-1-ylpropanediamide |
|---|---|
| PubChem CID | 123380917 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-amino-N-cyclohexa-2,4-dien-1-yl-N'-cyclohex-3-en-1-ylpropanediamide |
| SMILES | NC(C(=O)NC1C=CC=CC1)C(=O)NC1CC=CCC1 |
| InChI | InChI=1S/C15H21N3O2/c16-13(14(19)17-11-7-3-1-4-8-11)15(20)18-12-9-5-2-6-10-12/h1-5,7,11-13H,6,8-10,16H2,(H,17,19)(H,18,20) |
| InChIKey | MJTOBLCTJUTDSQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|