C8H14N2O — CID 104863900
(2R)-2-amino-N-cyclopent-3-en-1-ylpropanamide (PubChem CID 104863900) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (2R)-2-amino-N-cyclopent-3-en-1-ylpropanamide.
| Compound Name | (2R)-2-amino-N-cyclopent-3-en-1-ylpropanamide |
|---|---|
| PubChem CID | 104863900 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (2R)-2-amino-N-cyclopent-3-en-1-ylpropanamide |
| SMILES | C[C@@H](N)C(=O)NC1CC=CC1 |
| InChI | InChI=1S/C8H14N2O/c1-6(9)8(11)10-7-4-2-3-5-7/h2-3,6-7H,4-5,9H2,1H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | HREFKUDCCJNBOS-ZCFIWIBFSA-N |
| XLogP | 0.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|