C8H16N2OS — CID 103796198
(2R)-2-amino-N-(thian-4-yl)propanamide (PubChem CID 103796198) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is (2R)-2-amino-N-(thian-4-yl)propanamide.
| Compound Name | (2R)-2-amino-N-(thian-4-yl)propanamide |
|---|---|
| PubChem CID | 103796198 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2R)-2-amino-N-(thian-4-yl)propanamide |
| SMILES | C[C@@H](N)C(=O)NC1CCSCC1 |
| InChI | InChI=1S/C8H16N2OS/c1-6(9)8(11)10-7-2-4-12-5-3-7/h6-7H,2-5,9H2,1H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | XTCVTJPLLHHUNU-ZCFIWIBFSA-N |
| XLogP | 0.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |