C11H16O — CID 163916851
5-(1-ethenoxypropan-2-yl)cyclohexa-1,3-diene (PubChem CID 163916851) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-(1-ethenoxypropan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(1-ethenoxypropan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163916851 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 5-(1-ethenoxypropan-2-yl)cyclohexa-1,3-diene |
| SMILES | C=COCC(C)C1C=CC=CC1 |
| InChI | InChI=1S/C11H16O/c1-3-12-9-10(2)11-7-5-4-6-8-11/h3-7,10-11H,1,8-9H2,2H3 |
| InChIKey | QWZYNENROMFYRT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|