C15H28O2S — CID 142978551
hydroxy-methylidene-oxo-pentyl-λ6-sulfane;5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 142978551) has the molecular formula C15H28O2S and a molecular weight of 272.45 g/mol. Its IUPAC name is hydroxy-methylidene-oxo-pentyl-λ6-sulfane;5-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | hydroxy-methylidene-oxo-pentyl-λ6-sulfane;5-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142978551 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | hydroxy-methylidene-oxo-pentyl-λ6-sulfane;5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | C=S(=O)(O)CCCCC.CC(C)C1C=CC=CC1 |
| InChI | InChI=1S/C9H14.C6H14O2S/c1-8(2)9-6-4-3-5-7-9;1-3-4-5-6-9(2,7)8/h3-6,8-9H,7H2,1-2H3;2-6H2,1H3,(H,7,8) |
| InChIKey | RQOQXVUEZNCILX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|