About heptane;propan-2-ol;sulfuric acid
heptane;propan-2-ol;sulfuric acid (PubChem CID 87329461) has the molecular formula C10H26O5S
and a molecular weight of 258.38 g/mol. Its IUPAC name is heptane;propan-2-ol;sulfuric acid.
Molecular Properties
| Compound Name | heptane;propan-2-ol;sulfuric acid |
| PubChem CID | 87329461 |
| Molecular Formula | C10H26O5S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | heptane;propan-2-ol;sulfuric acid |
| SMILES | CC(C)O.CCCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C7H16.C3H8O.H2O4S/c1-3-5-7-6-4-2;1-3(2)4;1-5(2,3)4/h3-7H2,1-2H3;3-4H,1-2H3;(H2,1,2,3,4) |
| InChIKey | LUENFFNOCSEYCG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze heptane;propan-2-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;propan-2-ol;sulfuric acid?
The IUPAC name of heptane;propan-2-ol;sulfuric acid (CID 87329461) is heptane;propan-2-ol;sulfuric acid.
What is the SMILES notation for heptane;propan-2-ol;sulfuric acid?
The canonical SMILES for heptane;propan-2-ol;sulfuric acid is CC(C)O.CCCCCCC.O=S(=O)(O)O.
What is the InChIKey of heptane;propan-2-ol;sulfuric acid?
The InChIKey is LUENFFNOCSEYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H8O.H2O4S/c1-3-5-7-6-4-2;1-3(2)4;1-5(2,3)4/h3-7H2,1-2H3;3-4H,1-2H3;(H2,1,2,3,4).
What are the key properties of heptane;propan-2-ol;sulfuric acid?
heptane;propan-2-ol;sulfuric acid has a molecular weight of 258.38 g/mol, XLogP of 2.71, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;propan-2-ol;sulfuric acid is sourced from PubChem (CID 87329461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).