N-(1-hydroxyethyl)dodecanamide;sulfuric acid

C14H31NO6S — CID 23284079

IUPACN-(1-hydroxyethyl)dodecanamide;sulfuric acid
SMILESCCCCCCCCCCCC(=O)NC(C)O.O=S(=O)(O)O
InChIInChI=1S/C14H29NO2.H2O4S/c1-3-4-5-6-7-8-9-10-11-12-14(17)15-13(2)16;1-5(2,3)4/h13,16H,3-12H2,1-2H3,(H,15,17);(H2,1,2,3,4)
InChIKeyHQLXUGPCPGMKHN-UHFFFAOYSA-N
MW341.47 g/mol
LogP2.71
Rot. Bonds11

About N-(1-hydroxyethyl)dodecanamide;sulfuric acid

N-(1-hydroxyethyl)dodecanamide;sulfuric acid (PubChem CID 23284079) has the molecular formula C14H31NO6S and a molecular weight of 341.47 g/mol. Its IUPAC name is N-(1-hydroxyethyl)dodecanamide;sulfuric acid.

Molecular Properties

Compound NameN-(1-hydroxyethyl)dodecanamide;sulfuric acid
PubChem CID23284079
Molecular FormulaC14H31NO6S
Molecular Weight341.47 g/mol
Exact Mass341.19
IUPAC NameN-(1-hydroxyethyl)dodecanamide;sulfuric acid
SMILESCCCCCCCCCCCC(=O)NC(C)O.O=S(=O)(O)O
InChIInChI=1S/C14H29NO2.H2O4S/c1-3-4-5-6-7-8-9-10-11-12-14(17)15-13(2)16;1-5(2,3)4/h13,16H,3-12H2,1-2H3,(H,15,17);(H2,1,2,3,4)
InChIKeyHQLXUGPCPGMKHN-UHFFFAOYSA-N
XLogP2.71
TPSA123.93 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds11
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.47
LogP ≤ 52.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze N-(1-hydroxyethyl)dodecanamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(1-hydroxyethyl)dodecanamide;sulfuric acid?
The IUPAC name of N-(1-hydroxyethyl)dodecanamide;sulfuric acid (CID 23284079) is N-(1-hydroxyethyl)dodecanamide;sulfuric acid.
What is the SMILES notation for N-(1-hydroxyethyl)dodecanamide;sulfuric acid?
The canonical SMILES for N-(1-hydroxyethyl)dodecanamide;sulfuric acid is CCCCCCCCCCCC(=O)NC(C)O.O=S(=O)(O)O.
What is the InChIKey of N-(1-hydroxyethyl)dodecanamide;sulfuric acid?
The InChIKey is HQLXUGPCPGMKHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2.H2O4S/c1-3-4-5-6-7-8-9-10-11-12-14(17)15-13(2)16;1-5(2,3)4/h13,16H,3-12H2,1-2H3,(H,15,17);(H2,1,2,3,4).
What are the key properties of N-(1-hydroxyethyl)dodecanamide;sulfuric acid?
N-(1-hydroxyethyl)dodecanamide;sulfuric acid has a molecular weight of 341.47 g/mol, XLogP of 2.71, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxyethyl)dodecanamide;sulfuric acid is sourced from PubChem (CID 23284079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).