C10H20N2 — CID 153348413
1-cyclohexa-2,4-dien-1-ylpropan-2-amine;methanamine (PubChem CID 153348413) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-ylpropan-2-amine;methanamine.
| Compound Name | 1-cyclohexa-2,4-dien-1-ylpropan-2-amine;methanamine |
|---|---|
| PubChem CID | 153348413 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-ylpropan-2-amine;methanamine |
| SMILES | CC(N)CC1C=CC=CC1.CN |
| InChI | InChI=1S/C9H15N.CH5N/c1-8(10)7-9-5-3-2-4-6-9;1-2/h2-5,8-9H,6-7,10H2,1H3;2H2,1H3 |
| InChIKey | WCNNEDXEQKZVAV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |