C11H11FO2 — CID 102650533
2,3-dihydrofuran-5-yl-(4-fluorophenyl)methanol (PubChem CID 102650533) has the molecular formula C11H11FO2 and a molecular weight of 194.21 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(4-fluorophenyl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 102650533 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(4-fluorophenyl)methanol |
| SMILES | OC(C1=CCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO2/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h2-6,11,13H,1,7H2 |
| InChIKey | JRIPLPUBVQAGOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |