C9H9BrO3 — CID 130174038
(3-bromofuran-2-yl)-(2,3-dihydrofuran-5-yl)methanol (PubChem CID 130174038) has the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(2,3-dihydrofuran-5-yl)methanol.
| Compound Name | (3-bromofuran-2-yl)-(2,3-dihydrofuran-5-yl)methanol |
|---|---|
| PubChem CID | 130174038 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | (3-bromofuran-2-yl)-(2,3-dihydrofuran-5-yl)methanol |
| SMILES | OC(C1=CCCO1)c1occc1Br |
| InChI | InChI=1S/C9H9BrO3/c10-6-3-5-13-9(6)8(11)7-2-1-4-12-7/h2-3,5,8,11H,1,4H2 |
| InChIKey | AYVJCJWRZUMWLX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |